C25H27IN2 — CID 142050148
N,N-dimethyl-4-[2-(3,3,6-trimethyl-5λ3-ioda-6-azatricyclo[8.4.0.02,7]tetradeca-1(14),2(7),4,8,10,12-hexaen-4-yl)ethenyl]aniline (PubChem CID 142050148) has the molecular formula C25H27IN2 and a molecular weight of 482.41 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(3,3,6-trimethyl-5λ3-ioda-6-azatricyclo[8.4.0.02,7]tetradeca-1(14),2(7),4,8,10,12-hexaen-4-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-(3,3,6-trimethyl-5λ3-ioda-6-azatricyclo[8.4.0.02,7]tetradeca-1(14),2(7),4,8,10,12-hexaen-4-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 142050148 |
| Molecular Formula | C25H27IN2 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N,N-dimethyl-4-[2-(3,3,6-trimethyl-5λ3-ioda-6-azatricyclo[8.4.0.02,7]tetradeca-1(14),2(7),4,8,10,12-hexaen-4-yl)ethenyl]aniline |
| SMILES | CN(C)c1ccc(C=CC2=IN(C)c3ccc4ccccc4c3C2(C)C)cc1 |
| InChI | InChI=1S/C25H27IN2/c1-25(2)23(17-12-18-10-14-20(15-11-18)27(3)4)26-28(5)22-16-13-19-8-6-7-9-21(19)24(22)25/h6-17H,1-5H3 |
| InChIKey | DKVRSOTYCNQDJF-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|