C22H30 — CID 144857232
(8Z)-7,8-bis(ethenyl)-10,11,11-trimethyl-7,10-dihydrobenzo[9]annulene;ethane (PubChem CID 144857232) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is (8Z)-7,8-bis(ethenyl)-10,11,11-trimethyl-7,10-dihydrobenzo[9]annulene;ethane.
| Compound Name | (8Z)-7,8-bis(ethenyl)-10,11,11-trimethyl-7,10-dihydrobenzo[9]annulene;ethane |
|---|---|
| PubChem CID | 144857232 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | (8Z)-7,8-bis(ethenyl)-10,11,11-trimethyl-7,10-dihydrobenzo[9]annulene;ethane |
| SMILES | C=C/C1=C/C(C)C(C)(C)c2ccccc2C=CC1C=C.CC |
| InChI | InChI=1S/C20H24.C2H6/c1-6-16-12-13-18-10-8-9-11-19(18)20(4,5)15(3)14-17(16)7-2;1-2/h6-16H,1-2H2,3-5H3;1-2H3/b13-12?,17-14-; |
| InChIKey | ANMVGQIZIOOBCF-LZOFPATOSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|