C19H17IO3 — CID 10047738
[1-(2-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-2-iodoethyl] acetate (PubChem CID 10047738) has the molecular formula C19H17IO3 and a molecular weight of 420.25 g/mol. Its IUPAC name is [1-(2-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-2-iodoethyl] acetate.
| Compound Name | [1-(2-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-2-iodoethyl] acetate |
|---|---|
| PubChem CID | 10047738 |
| Molecular Formula | C19H17IO3 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | [1-(2-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-2-iodoethyl] acetate |
| SMILES | CC(=O)OC(CI)C1(O)c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C19H17IO3/c1-13(21)23-18(12-20)19(22)16-8-4-2-6-14(16)10-11-15-7-3-5-9-17(15)19/h2-11,18,22H,12H2,1H3 |
| InChIKey | QOKKRIYZMYTUEJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|