C25H23NO2S — CID 70053909
(2R)-2-amino-3-[[2-(4-methylphenyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]sulfanyl]propanoic acid (PubChem CID 70053909) has the molecular formula C25H23NO2S and a molecular weight of 401.53 g/mol. Its IUPAC name is (2R)-2-amino-3-[[2-(4-methylphenyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]sulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[2-(4-methylphenyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 70053909 |
| Molecular Formula | C25H23NO2S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (2R)-2-amino-3-[[2-(4-methylphenyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]sulfanyl]propanoic acid |
| SMILES | Cc1ccc(C2(SC[C@H](N)C(=O)O)c3ccccc3C=Cc3ccccc32)cc1 |
| InChI | InChI=1S/C25H23NO2S/c1-17-10-14-20(15-11-17)25(29-16-23(26)24(27)28)21-8-4-2-6-18(21)12-13-19-7-3-5-9-22(19)25/h2-15,23H,16,26H2,1H3,(H,27,28)/t23-/m0/s1 |
| InChIKey | KCUGWQRFPCYWEP-QHCPKHFHSA-N |
| XLogP | 4.92 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|