C25H22F3NO2S — CID 122195344
(2R)-2-amino-3-[[2-[3-(trifluoromethyl)phenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]sulfanyl]propanoic acid (PubChem CID 122195344) has the molecular formula C25H22F3NO2S and a molecular weight of 457.52 g/mol. Its IUPAC name is (2R)-2-amino-3-[[2-[3-(trifluoromethyl)phenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]sulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[2-[3-(trifluoromethyl)phenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 122195344 |
| Molecular Formula | C25H22F3NO2S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (2R)-2-amino-3-[[2-[3-(trifluoromethyl)phenyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]sulfanyl]propanoic acid |
| SMILES | N[C@@H](CSC1(c2cccc(C(F)(F)F)c2)c2ccccc2CCc2ccccc21)C(=O)O |
| InChI | InChI=1S/C25H22F3NO2S/c26-25(27,28)19-9-5-8-18(14-19)24(32-15-22(29)23(30)31)20-10-3-1-6-16(20)12-13-17-7-2-4-11-21(17)24/h1-11,14,22H,12-13,15,29H2,(H,30,31)/t22-/m0/s1 |
| InChIKey | DODOYAOQISACCJ-QFIPXVFZSA-N |
| XLogP | 5.24 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |