C29H22F3NOS — CID 66575500
(3S)-1-benzyl-3-benzylsulfanyl-3-[3-(trifluoromethyl)phenyl]indol-2-one (PubChem CID 66575500) has the molecular formula C29H22F3NOS and a molecular weight of 489.56 g/mol. Its IUPAC name is (3S)-1-benzyl-3-benzylsulfanyl-3-[3-(trifluoromethyl)phenyl]indol-2-one.
| Compound Name | (3S)-1-benzyl-3-benzylsulfanyl-3-[3-(trifluoromethyl)phenyl]indol-2-one |
|---|---|
| PubChem CID | 66575500 |
| Molecular Formula | C29H22F3NOS |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | (3S)-1-benzyl-3-benzylsulfanyl-3-[3-(trifluoromethyl)phenyl]indol-2-one |
| SMILES | O=C1N(Cc2ccccc2)c2ccccc2[C@@]1(SCc1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H22F3NOS/c30-29(31,32)24-15-9-14-23(18-24)28(35-20-22-12-5-2-6-13-22)25-16-7-8-17-26(25)33(27(28)34)19-21-10-3-1-4-11-21/h1-18H,19-20H2/t28-/m0/s1 |
| InChIKey | INQWWBAGJQOGCN-NDEPHWFRSA-N |
| XLogP | 7.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |