C23H17F3INO — CID 138984763
1-benzyl-3-(iodomethyl)-3-phenyl-5-(trifluoromethyl)indol-2-one (PubChem CID 138984763) has the molecular formula C23H17F3INO and a molecular weight of 507.29 g/mol. Its IUPAC name is 1-benzyl-3-(iodomethyl)-3-phenyl-5-(trifluoromethyl)indol-2-one.
| Compound Name | 1-benzyl-3-(iodomethyl)-3-phenyl-5-(trifluoromethyl)indol-2-one |
|---|---|
| PubChem CID | 138984763 |
| Molecular Formula | C23H17F3INO |
| Molecular Weight | 507.29 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | 1-benzyl-3-(iodomethyl)-3-phenyl-5-(trifluoromethyl)indol-2-one |
| SMILES | O=C1N(Cc2ccccc2)c2ccc(C(F)(F)F)cc2C1(CI)c1ccccc1 |
| InChI | InChI=1S/C23H17F3INO/c24-23(25,26)18-11-12-20-19(13-18)22(15-27,17-9-5-2-6-10-17)21(29)28(20)14-16-7-3-1-4-8-16/h1-13H,14-15H2 |
| InChIKey | YLGNCXWSBNBVDJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.29 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|