C15H14N6S — CID 132537247
12-azido-7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene (PubChem CID 132537247) has the molecular formula C15H14N6S and a molecular weight of 310.39 g/mol. Its IUPAC name is 12-azido-7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene.
| Compound Name | 12-azido-7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 132537247 |
| Molecular Formula | C15H14N6S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 12-azido-7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene |
| SMILES | CC(C)c1nc2sc3c(N=[N+]=[N-])ncnc3c2c2c1CCC2 |
| InChI | InChI=1S/C15H14N6S/c1-7(2)11-9-5-3-4-8(9)10-12-13(22-15(10)19-11)14(20-21-16)18-6-17-12/h6-7H,3-5H2,1-2H3 |
| InChIKey | KKQRJCKTGKMPCW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 87.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|