C16H16N3S3- — CID 7633161
14-methylsulfanyl-7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene-12-thiolate (PubChem CID 7633161) has the molecular formula C16H16N3S3- and a molecular weight of 346.53 g/mol. Its IUPAC name is 14-methylsulfanyl-7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene-12-thiolate.
| Compound Name | 14-methylsulfanyl-7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene-12-thiolate |
|---|---|
| PubChem CID | 7633161 |
| Molecular Formula | C16H16N3S3- |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 14-methylsulfanyl-7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene-12-thiolate |
| SMILES | CSc1nc([S-])c2sc3nc(C(C)C)c4c(c3c2n1)CCC4 |
| InChI | InChI=1S/C16H17N3S3/c1-7(2)11-9-6-4-5-8(9)10-12-13(22-15(10)17-11)14(20)19-16(18-12)21-3/h7H,4-6H2,1-3H3,(H,18,19,20)/p-1 |
| InChIKey | FLDQJIFUWKXKPT-UHFFFAOYSA-M |
| XLogP | 4.48 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|