C21H28N4O2S2 — CID 2008872
N-(2,2-dimethoxyethyl)-7-(2-methylpropyl)-14-methylsulfanyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine (PubChem CID 2008872) has the molecular formula C21H28N4O2S2 and a molecular weight of 432.62 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-7-(2-methylpropyl)-14-methylsulfanyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-7-(2-methylpropyl)-14-methylsulfanyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine |
|---|---|
| PubChem CID | 2008872 |
| Molecular Formula | C21H28N4O2S2 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-7-(2-methylpropyl)-14-methylsulfanyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine |
| SMILES | COC(CNc1nc(SC)nc2c1sc1nc(CC(C)C)c3c(c12)CCC3)OC |
| InChI | InChI=1S/C21H28N4O2S2/c1-11(2)9-14-12-7-6-8-13(12)16-17-18(29-20(16)23-14)19(25-21(24-17)28-5)22-10-15(26-3)27-4/h11,15H,6-10H2,1-5H3,(H,22,24,25) |
| InChIKey | RZDNXSLAMHPDPW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|