C19H25N5OS2 — CID 2042229
[4,4-dimethyl-8-(2-methylpropyl)-15-methylsulfanyl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl]hydrazine (PubChem CID 2042229) has the molecular formula C19H25N5OS2 and a molecular weight of 403.58 g/mol. Its IUPAC name is [4,4-dimethyl-8-(2-methylpropyl)-15-methylsulfanyl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl]hydrazine.
| Compound Name | [4,4-dimethyl-8-(2-methylpropyl)-15-methylsulfanyl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl]hydrazine |
|---|---|
| PubChem CID | 2042229 |
| Molecular Formula | C19H25N5OS2 |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [4,4-dimethyl-8-(2-methylpropyl)-15-methylsulfanyl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl]hydrazine |
| SMILES | CSc1nc(NN)c2sc3nc(CC(C)C)c4c(c3c2n1)CC(C)(C)OC4 |
| InChI | InChI=1S/C19H25N5OS2/c1-9(2)6-12-11-8-25-19(3,4)7-10(11)13-14-15(27-17(13)21-12)16(24-20)23-18(22-14)26-5/h9H,6-8,20H2,1-5H3,(H,22,23,24) |
| InChIKey | IGIRVBDAPLDLKC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|