C20H23N3S3 — CID 3842525
7-(2-methylpropyl)-14-methylsulfanyl-12-prop-2-enylsulfanyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene (PubChem CID 3842525) has the molecular formula C20H23N3S3 and a molecular weight of 401.63 g/mol. Its IUPAC name is 7-(2-methylpropyl)-14-methylsulfanyl-12-prop-2-enylsulfanyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene.
| Compound Name | 7-(2-methylpropyl)-14-methylsulfanyl-12-prop-2-enylsulfanyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 3842525 |
| Molecular Formula | C20H23N3S3 |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 7-(2-methylpropyl)-14-methylsulfanyl-12-prop-2-enylsulfanyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaene |
| SMILES | C=CCSc1nc(SC)nc2c1sc1nc(CC(C)C)c3c(c12)CCC3 |
| InChI | InChI=1S/C20H23N3S3/c1-5-9-25-19-17-16(22-20(23-19)24-4)15-13-8-6-7-12(13)14(10-11(2)3)21-18(15)26-17/h5,11H,1,6-10H2,2-4H3 |
| InChIKey | OSOCGYDMYHSJPH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|