C26H22N4S2 — CID 2017343
N-benzyl-14-methylsulfanyl-7-phenyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine (PubChem CID 2017343) has the molecular formula C26H22N4S2 and a molecular weight of 454.62 g/mol. Its IUPAC name is N-benzyl-14-methylsulfanyl-7-phenyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine.
| Compound Name | N-benzyl-14-methylsulfanyl-7-phenyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine |
|---|---|
| PubChem CID | 2017343 |
| Molecular Formula | C26H22N4S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-benzyl-14-methylsulfanyl-7-phenyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine |
| SMILES | CSc1nc(NCc2ccccc2)c2sc3nc(-c4ccccc4)c4c(c3c2n1)CCC4 |
| InChI | InChI=1S/C26H22N4S2/c1-31-26-29-22-20-18-13-8-14-19(18)21(17-11-6-3-7-12-17)28-25(20)32-23(22)24(30-26)27-15-16-9-4-2-5-10-16/h2-7,9-12H,8,13-15H2,1H3,(H,27,29,30) |
| InChIKey | AZFPABGYLVKDSJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |