C20H17N3S2 — CID 4001488
13-methylsulfanyl-8-phenyl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene (PubChem CID 4001488) has the molecular formula C20H17N3S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 13-methylsulfanyl-8-phenyl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene.
| Compound Name | 13-methylsulfanyl-8-phenyl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene |
|---|---|
| PubChem CID | 4001488 |
| Molecular Formula | C20H17N3S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 13-methylsulfanyl-8-phenyl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene |
| SMILES | CSc1ncnc2c1sc1nc(-c3ccccc3)c3c(c12)CCCC3 |
| InChI | InChI=1S/C20H17N3S2/c1-24-20-18-17(21-11-22-20)15-13-9-5-6-10-14(13)16(23-19(15)25-18)12-7-3-2-4-8-12/h2-4,7-8,11H,5-6,9-10H2,1H3 |
| InChIKey | SYIBFBOCUCBMIQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |