C19H17N5S2 — CID 2006467
(14-methylsulfanyl-7-phenyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-yl)hydrazine (PubChem CID 2006467) has the molecular formula C19H17N5S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is (14-methylsulfanyl-7-phenyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-yl)hydrazine.
| Compound Name | (14-methylsulfanyl-7-phenyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-yl)hydrazine |
|---|---|
| PubChem CID | 2006467 |
| Molecular Formula | C19H17N5S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | (14-methylsulfanyl-7-phenyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-yl)hydrazine |
| SMILES | CSc1nc(NN)c2sc3nc(-c4ccccc4)c4c(c3c2n1)CCC4 |
| InChI | InChI=1S/C19H17N5S2/c1-25-19-22-15-13-11-8-5-9-12(11)14(10-6-3-2-4-7-10)21-18(13)26-16(15)17(23-19)24-20/h2-4,6-7H,5,8-9,20H2,1H3,(H,22,23,24) |
| InChIKey | ZJZHAGLPACYVPL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|