C19H24N4O2S — CID 2037210
2-[2-[(7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-yl)amino]ethoxy]ethanol (PubChem CID 2037210) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-[2-[(7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 2037210 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[2-[(7-propan-2-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-yl)amino]ethoxy]ethanol |
| SMILES | CC(C)c1nc2sc3c(NCCOCCO)ncnc3c2c2c1CCC2 |
| InChI | InChI=1S/C19H24N4O2S/c1-11(2)15-13-5-3-4-12(13)14-16-17(26-19(14)23-15)18(22-10-21-16)20-6-8-25-9-7-24/h10-11,24H,3-9H2,1-2H3,(H,20,21,22) |
| InChIKey | OCYSUAQILNHXLE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|