C20H28O2 — CID 132537408
6-hept-2-ynyltrideca-2,8-diynoic acid (PubChem CID 132537408) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 6-hept-2-ynyltrideca-2,8-diynoic acid.
| Compound Name | 6-hept-2-ynyltrideca-2,8-diynoic acid |
|---|---|
| PubChem CID | 132537408 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 6-hept-2-ynyltrideca-2,8-diynoic acid |
| SMILES | CCCCC#CCC(CC#CCCCC)CCC#CC(=O)O |
| InChI | InChI=1S/C20H28O2/c1-3-5-7-9-11-15-19(16-12-10-8-6-4-2)17-13-14-18-20(21)22/h19H,3-8,13,15-17H2,1-2H3,(H,21,22) |
| InChIKey | DFGGPNHWTXKBAH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|