C21H18N2O5 — CID 132537764
(3E)-3-(imidazo[1,2-a]pyridin-3-ylmethylidene)-5-(3,4,5-trimethoxyphenyl)furan-2-one (PubChem CID 132537764) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is (3E)-3-(imidazo[1,2-a]pyridin-3-ylmethylidene)-5-(3,4,5-trimethoxyphenyl)furan-2-one.
| Compound Name | (3E)-3-(imidazo[1,2-a]pyridin-3-ylmethylidene)-5-(3,4,5-trimethoxyphenyl)furan-2-one |
|---|---|
| PubChem CID | 132537764 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (3E)-3-(imidazo[1,2-a]pyridin-3-ylmethylidene)-5-(3,4,5-trimethoxyphenyl)furan-2-one |
| SMILES | COc1cc(C2=C/C(=C\c3cnc4ccccn34)C(=O)O2)cc(OC)c1OC |
| InChI | InChI=1S/C21H18N2O5/c1-25-17-9-13(10-18(26-2)20(17)27-3)16-11-14(21(24)28-16)8-15-12-22-19-6-4-5-7-23(15)19/h4-12H,1-3H3/b14-8+ |
| InChIKey | AOWKKWWJRYKIPE-RIYZIHGNSA-N |
| XLogP | 3.34 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|