C18H14N4O2 — CID 10805494
(5Z)-5-(imidazo[1,2-a]pyridin-3-ylmethylidene)-2-methoxy-3-phenylimidazol-4-one (PubChem CID 10805494) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is (5Z)-5-(imidazo[1,2-a]pyridin-3-ylmethylidene)-2-methoxy-3-phenylimidazol-4-one.
| Compound Name | (5Z)-5-(imidazo[1,2-a]pyridin-3-ylmethylidene)-2-methoxy-3-phenylimidazol-4-one |
|---|---|
| PubChem CID | 10805494 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (5Z)-5-(imidazo[1,2-a]pyridin-3-ylmethylidene)-2-methoxy-3-phenylimidazol-4-one |
| SMILES | COC1=N/C(=C\c2cnc3ccccn23)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H14N4O2/c1-24-18-20-15(17(23)22(18)13-7-3-2-4-8-13)11-14-12-19-16-9-5-6-10-21(14)16/h2-12H,1H3/b15-11- |
| InChIKey | FYEKMTDBFDQSRV-PTNGSMBKSA-N |
| XLogP | 2.72 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|