C13H14N2OS — CID 170480250
S-(4-imidazo[1,2-a]pyridin-3-ylbut-3-enyl) ethanethioate (PubChem CID 170480250) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is S-(4-imidazo[1,2-a]pyridin-3-ylbut-3-enyl) ethanethioate.
| Compound Name | S-(4-imidazo[1,2-a]pyridin-3-ylbut-3-enyl) ethanethioate |
|---|---|
| PubChem CID | 170480250 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | S-(4-imidazo[1,2-a]pyridin-3-ylbut-3-enyl) ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cnc2ccccn12 |
| InChI | InChI=1S/C13H14N2OS/c1-11(16)17-9-5-3-6-12-10-14-13-7-2-4-8-15(12)13/h2-4,6-8,10H,5,9H2,1H3 |
| InChIKey | KJYKMJINDIDAIS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|