About N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide
N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide (PubChem CID 170488830) has the molecular formula C12H14N4O
and a molecular weight of 230.27 g/mol. Its IUPAC name is N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide.
Molecular Properties
| Compound Name | N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide |
| PubChem CID | 170488830 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide |
| SMILES | CC(=O)NCCC=Cc1cnc2cnccn12 |
| InChI | InChI=1S/C12H14N4O/c1-10(17)14-5-3-2-4-11-8-15-12-9-13-6-7-16(11)12/h2,4,6-9H,3,5H2,1H3,(H,14,17) |
| InChIKey | ROZDRAZJEGGTJH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide?
The IUPAC name of N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide (CID 170488830) is N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide.
What is the SMILES notation for N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide?
The canonical SMILES for N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide is CC(=O)NCCC=Cc1cnc2cnccn12.
What is the InChIKey of N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide?
The InChIKey is ROZDRAZJEGGTJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O/c1-10(17)14-5-3-2-4-11-8-15-12-9-13-6-7-16(11)12/h2,4,6-9H,3,5H2,1H3,(H,14,17).
What are the key properties of N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide?
N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide has a molecular weight of 230.27 g/mol, XLogP of 1.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-imidazo[1,2-a]pyrazin-3-ylbut-3-enyl)acetamide is sourced from PubChem (CID 170488830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).