C10H12N4 — CID 170487096
4-imidazo[1,2-a]pyrazin-3-ylbut-3-en-1-amine (PubChem CID 170487096) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyrazin-3-ylbut-3-en-1-amine.
| Compound Name | 4-imidazo[1,2-a]pyrazin-3-ylbut-3-en-1-amine |
|---|---|
| PubChem CID | 170487096 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 4-imidazo[1,2-a]pyrazin-3-ylbut-3-en-1-amine |
| SMILES | NCCC=Cc1cnc2cnccn12 |
| InChI | InChI=1S/C10H12N4/c11-4-2-1-3-9-7-13-10-8-12-5-6-14(9)10/h1,3,5-8H,2,4,11H2 |
| InChIKey | SZFCUXHIOZWETC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |