C11H12N2 — CID 16741623
3-[(E)-but-1-enyl]imidazo[1,2-a]pyridine (PubChem CID 16741623) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 3-[(E)-but-1-enyl]imidazo[1,2-a]pyridine.
| Compound Name | 3-[(E)-but-1-enyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 16741623 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 3-[(E)-but-1-enyl]imidazo[1,2-a]pyridine |
| SMILES | CC/C=C/c1cnc2ccccn12 |
| InChI | InChI=1S/C11H12N2/c1-2-3-6-10-9-12-11-7-4-5-8-13(10)11/h3-9H,2H2,1H3/b6-3+ |
| InChIKey | YECFTXDCEZJBQY-ZZXKWVIFSA-N |
| XLogP | 2.76 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |