C20H25NO4 — CID 132539310
dimethyl (2S,3S,8aR)-3-[(E)-2-phenylethenyl]-2,3,5,6,7,8-hexahydro-1H-indolizine-2,8a-dicarboxylate (PubChem CID 132539310) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is dimethyl (2S,3S,8aR)-3-[(E)-2-phenylethenyl]-2,3,5,6,7,8-hexahydro-1H-indolizine-2,8a-dicarboxylate.
| Compound Name | dimethyl (2S,3S,8aR)-3-[(E)-2-phenylethenyl]-2,3,5,6,7,8-hexahydro-1H-indolizine-2,8a-dicarboxylate |
|---|---|
| PubChem CID | 132539310 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | dimethyl (2S,3S,8aR)-3-[(E)-2-phenylethenyl]-2,3,5,6,7,8-hexahydro-1H-indolizine-2,8a-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@]2(C(=O)OC)CCCCN2[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H25NO4/c1-24-18(22)16-14-20(19(23)25-2)12-6-7-13-21(20)17(16)11-10-15-8-4-3-5-9-15/h3-5,8-11,16-17H,6-7,12-14H2,1-2H3/b11-10+/t16-,17-,20+/m0/s1 |
| InChIKey | MVIPFWGYHJVGFS-BHUFXXOFSA-N |
| XLogP | 2.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |