C16H14BN3O5 — CID 132540338
2-amino-4-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)-5-phenylfuran-3-carbonitrile (PubChem CID 132540338) has the molecular formula C16H14BN3O5 and a molecular weight of 339.12 g/mol. Its IUPAC name is 2-amino-4-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)-5-phenylfuran-3-carbonitrile.
| Compound Name | 2-amino-4-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)-5-phenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 132540338 |
| Molecular Formula | C16H14BN3O5 |
| Molecular Weight | 339.12 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-amino-4-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)-5-phenylfuran-3-carbonitrile |
| SMILES | CN1CC(=O)OB(c2c(-c3ccccc3)oc(N)c2C#N)OC(=O)C1 |
| InChI | InChI=1S/C16H14BN3O5/c1-20-8-12(21)24-17(25-13(22)9-20)14-11(7-18)16(19)23-15(14)10-5-3-2-4-6-10/h2-6H,8-9,19H2,1H3 |
| InChIKey | KBUYOCNEZYFNJO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.12 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|