C12H8N4O — CID 91735906
2-amino-5-(3-aminophenyl)furan-3,4-dicarbonitrile (PubChem CID 91735906) has the molecular formula C12H8N4O and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-amino-5-(3-aminophenyl)furan-3,4-dicarbonitrile.
| Compound Name | 2-amino-5-(3-aminophenyl)furan-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 91735906 |
| Molecular Formula | C12H8N4O |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-amino-5-(3-aminophenyl)furan-3,4-dicarbonitrile |
| SMILES | N#Cc1c(N)oc(-c2cccc(N)c2)c1C#N |
| InChI | InChI=1S/C12H8N4O/c13-5-9-10(6-14)12(16)17-11(9)7-2-1-3-8(15)4-7/h1-4H,15-16H2 |
| InChIKey | HSOSNJJGUMUTJT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|