C17H25N5O2S — CID 132541320
tert-butyl N-[(2S)-1-(benzotriazole-1-carbothioylamino)-3-methylbutan-2-yl]carbamate (PubChem CID 132541320) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(benzotriazole-1-carbothioylamino)-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(benzotriazole-1-carbothioylamino)-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 132541320 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-(benzotriazole-1-carbothioylamino)-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](CNC(=S)n1nnc2ccccc21)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25N5O2S/c1-11(2)13(19-16(23)24-17(3,4)5)10-18-15(25)22-14-9-7-6-8-12(14)20-21-22/h6-9,11,13H,10H2,1-5H3,(H,18,25)(H,19,23)/t13-/m1/s1 |
| InChIKey | GVEDJTRFZNSKGI-CYBMUJFWSA-N |
| XLogP | 2.70 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|