C30H32N4O3 — CID 132542036
butyl (E)-3-[1-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]naphthalen-2-yl]prop-2-enoate (PubChem CID 132542036) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is butyl (E)-3-[1-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]naphthalen-2-yl]prop-2-enoate.
| Compound Name | butyl (E)-3-[1-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]naphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 132542036 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | butyl (E)-3-[1-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]naphthalen-2-yl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1ccc2ccccc2c1CC(=O)NC(C)(C)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C30H32N4O3/c1-4-5-19-37-29(36)18-17-23-16-15-22-11-9-10-14-25(22)26(23)20-28(35)31-30(2,3)27-21-34(33-32-27)24-12-7-6-8-13-24/h6-18,21H,4-5,19-20H2,1-3H3,(H,31,35)/b18-17+ |
| InChIKey | KDZCUTQZGOXFTR-ISLYRVAYSA-N |
| XLogP | 5.37 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|