C26H29FN4O3 — CID 132542031
butyl (E)-3-[3-fluoro-2-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]phenyl]prop-2-enoate (PubChem CID 132542031) has the molecular formula C26H29FN4O3 and a molecular weight of 464.54 g/mol. Its IUPAC name is butyl (E)-3-[3-fluoro-2-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]phenyl]prop-2-enoate.
| Compound Name | butyl (E)-3-[3-fluoro-2-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 132542031 |
| Molecular Formula | C26H29FN4O3 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | butyl (E)-3-[3-fluoro-2-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]phenyl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1cccc(F)c1CC(=O)NC(C)(C)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C26H29FN4O3/c1-4-5-16-34-25(33)15-14-19-10-9-13-22(27)21(19)17-24(32)28-26(2,3)23-18-31(30-29-23)20-11-7-6-8-12-20/h6-15,18H,4-5,16-17H2,1-3H3,(H,28,32)/b15-14+ |
| InChIKey | WFHQQURUXCZMAA-CCEZHUSRSA-N |
| XLogP | 4.36 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|