C34H42N4O5 — CID 132542038
butyl (E)-3-[3-[(E)-3-butoxy-3-oxoprop-1-enyl]-5-methyl-2-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]phenyl]prop-2-enoate (PubChem CID 132542038) has the molecular formula C34H42N4O5 and a molecular weight of 586.73 g/mol. Its IUPAC name is butyl (E)-3-[3-[(E)-3-butoxy-3-oxoprop-1-enyl]-5-methyl-2-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]phenyl]prop-2-enoate.
| Compound Name | butyl (E)-3-[3-[(E)-3-butoxy-3-oxoprop-1-enyl]-5-methyl-2-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 132542038 |
| Molecular Formula | C34H42N4O5 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | butyl (E)-3-[3-[(E)-3-butoxy-3-oxoprop-1-enyl]-5-methyl-2-[2-oxo-2-[2-(1-phenyltriazol-4-yl)propan-2-ylamino]ethyl]phenyl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1cc(C)cc(/C=C/C(=O)OCCCC)c1CC(=O)NC(C)(C)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C34H42N4O5/c1-6-8-19-42-32(40)17-15-26-21-25(3)22-27(16-18-33(41)43-20-9-7-2)29(26)23-31(39)35-34(4,5)30-24-38(37-36-30)28-13-11-10-12-14-28/h10-18,21-22,24H,6-9,19-20,23H2,1-5H3,(H,35,39)/b17-15+,18-16+ |
| InChIKey | WRRLRSVWCDMAPW-YTEMWHBBSA-N |
| XLogP | 5.88 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|