C11H18O5S2 — CID 132542141
5-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]-1,3-oxathiolane-2-thione (PubChem CID 132542141) has the molecular formula C11H18O5S2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 5-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]-1,3-oxathiolane-2-thione.
| Compound Name | 5-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]-1,3-oxathiolane-2-thione |
|---|---|
| PubChem CID | 132542141 |
| Molecular Formula | C11H18O5S2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]-1,3-oxathiolane-2-thione |
| SMILES | S=C1OC(COCCOCCOCC2CO2)CS1 |
| InChI | InChI=1S/C11H18O5S2/c17-11-16-10(8-18-11)6-14-4-2-12-1-3-13-5-9-7-15-9/h9-10H,1-8H2 |
| InChIKey | NAVHGPNGYHGOEV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|