C15H26O7S2 — CID 132542143
5-[2-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]-1,3-oxathiolane-2-thione (PubChem CID 132542143) has the molecular formula C15H26O7S2 and a molecular weight of 382.50 g/mol. Its IUPAC name is 5-[2-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]-1,3-oxathiolane-2-thione.
| Compound Name | 5-[2-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]-1,3-oxathiolane-2-thione |
|---|---|
| PubChem CID | 132542143 |
| Molecular Formula | C15H26O7S2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 5-[2-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]-1,3-oxathiolane-2-thione |
| SMILES | S=C1OC(COCCOCCOCCOCCOCC2CO2)CS1 |
| InChI | InChI=1S/C15H26O7S2/c23-15-22-14(12-24-15)10-20-8-6-18-4-2-16-1-3-17-5-7-19-9-13-11-21-13/h13-14H,1-12H2 |
| InChIKey | MPZDTHNIXPZTBY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|