C23H29NO2 — CID 132542798
(1R,6S,7R)-7-[benzyl-[(1S)-1-phenylethyl]amino]-6-(hydroxymethyl)cyclohept-3-en-1-ol (PubChem CID 132542798) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (1R,6S,7R)-7-[benzyl-[(1S)-1-phenylethyl]amino]-6-(hydroxymethyl)cyclohept-3-en-1-ol.
| Compound Name | (1R,6S,7R)-7-[benzyl-[(1S)-1-phenylethyl]amino]-6-(hydroxymethyl)cyclohept-3-en-1-ol |
|---|---|
| PubChem CID | 132542798 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (1R,6S,7R)-7-[benzyl-[(1S)-1-phenylethyl]amino]-6-(hydroxymethyl)cyclohept-3-en-1-ol |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@@H]1[C@@H](CO)CC=CC[C@H]1O |
| InChI | InChI=1S/C23H29NO2/c1-18(20-12-6-3-7-13-20)24(16-19-10-4-2-5-11-19)23-21(17-25)14-8-9-15-22(23)26/h2-13,18,21-23,25-26H,14-17H2,1H3/t18-,21+,22+,23+/m0/s1 |
| InChIKey | FPZJSRFKQVCXLT-JBJBFBLISA-N |
| XLogP | 3.94 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|