About (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine
(3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine (PubChem CID 16725041) has the molecular formula C27H32N2
and a molecular weight of 384.57 g/mol. Its IUPAC name is (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine.
Molecular Properties
| Compound Name | (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine |
| PubChem CID | 16725041 |
| Molecular Formula | C27H32N2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine |
| SMILES | C[C@H]1CN(Cc2ccccc2)C[C@@H]1N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H32N2/c1-22-18-28(19-24-12-6-3-7-13-24)21-27(22)29(20-25-14-8-4-9-15-25)23(2)26-16-10-5-11-17-26/h3-17,22-23,27H,18-21H2,1-2H3/t22-,23-,27-/m0/s1 |
| InChIKey | DLZUOKUBZQRDJU-WCYRKSIYSA-N |
| XLogP | 5.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine?
The IUPAC name of (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine (CID 16725041) is (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine.
What is the SMILES notation for (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine?
The canonical SMILES for (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine is C[C@H]1CN(Cc2ccccc2)C[C@@H]1N(Cc1ccccc1)[C@@H](C)c1ccccc1.
What is the InChIKey of (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine?
The InChIKey is DLZUOKUBZQRDJU-WCYRKSIYSA-N. The full InChI is InChI=1S/C27H32N2/c1-22-18-28(19-24-12-6-3-7-13-24)21-27(22)29(20-25-14-8-4-9-15-25)23(2)26-16-10-5-11-17-26/h3-17,22-23,27H,18-21H2,1-2H3/t22-,23-,27-/m0/s1.
What are the key properties of (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine?
(3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine has a molecular weight of 384.57 g/mol, XLogP of 5.77, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine is sourced from PubChem (CID 16725041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).