C27H32N2 — CID 16725041
(3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine (PubChem CID 16725041) has the molecular formula C27H32N2 and a molecular weight of 384.57 g/mol. Its IUPAC name is (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine.
| Compound Name | (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 16725041 |
| Molecular Formula | C27H32N2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | (3R,4S)-N,1-dibenzyl-4-methyl-N-[(1S)-1-phenylethyl]pyrrolidin-3-amine |
| SMILES | C[C@H]1CN(Cc2ccccc2)C[C@@H]1N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H32N2/c1-22-18-28(19-24-12-6-3-7-13-24)21-27(22)29(20-25-14-8-4-9-15-25)23(2)26-16-10-5-11-17-26/h3-17,22-23,27H,18-21H2,1-2H3/t22-,23-,27-/m0/s1 |
| InChIKey | DLZUOKUBZQRDJU-WCYRKSIYSA-N |
| XLogP | 5.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |