C26H30N2O — CID 16724918
(3R,4S)-1-benzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-3-ol (PubChem CID 16724918) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-3-ol.
| Compound Name | (3R,4S)-1-benzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 16724918 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (3R,4S)-1-benzyl-4-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidin-3-ol |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@H]1CN(Cc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C26H30N2O/c1-21(24-15-9-4-10-16-24)28(18-23-13-7-3-8-14-23)25-19-27(20-26(25)29)17-22-11-5-2-6-12-22/h2-16,21,25-26,29H,17-20H2,1H3/t21-,25-,26+/m0/s1 |
| InChIKey | RLCCSEOJERJTRK-OUIFVKKZSA-N |
| XLogP | 4.50 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |