C25H32F2N2O2 — CID 175260038
5-[(3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4,4-difluoropiperidin-1-yl]pentanoic acid (PubChem CID 175260038) has the molecular formula C25H32F2N2O2 and a molecular weight of 430.54 g/mol. Its IUPAC name is 5-[(3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4,4-difluoropiperidin-1-yl]pentanoic acid.
| Compound Name | 5-[(3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4,4-difluoropiperidin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 175260038 |
| Molecular Formula | C25H32F2N2O2 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 5-[(3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4,4-difluoropiperidin-1-yl]pentanoic acid |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@H]1CN(CCCCC(=O)O)CCC1(F)F |
| InChI | InChI=1S/C25H32F2N2O2/c1-20(22-12-6-3-7-13-22)29(18-21-10-4-2-5-11-21)23-19-28(17-15-25(23,26)27)16-9-8-14-24(30)31/h2-7,10-13,20,23H,8-9,14-19H2,1H3,(H,30,31)/t20-,23-/m0/s1 |
| InChIKey | OKOGMOCQQNYVLD-REWPJTCUSA-N |
| XLogP | 5.21 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|