C17H18O2 — CID 132544349
(2S,3S)-2-[(3,5-dimethylphenoxy)methyl]-3-phenyloxirane (PubChem CID 132544349) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (2S,3S)-2-[(3,5-dimethylphenoxy)methyl]-3-phenyloxirane.
| Compound Name | (2S,3S)-2-[(3,5-dimethylphenoxy)methyl]-3-phenyloxirane |
|---|---|
| PubChem CID | 132544349 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2S,3S)-2-[(3,5-dimethylphenoxy)methyl]-3-phenyloxirane |
| SMILES | Cc1cc(C)cc(OC[C@@H]2O[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C17H18O2/c1-12-8-13(2)10-15(9-12)18-11-16-17(19-16)14-6-4-3-5-7-14/h3-10,16-17H,11H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | SYBWJHHWMTTYEN-IRXDYDNUSA-N |
| XLogP | 3.82 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|