C15H20O2 — CID 20591378
2-[(2,2-dimethylcyclopropyl)methoxymethyl]-3-phenyloxirane (PubChem CID 20591378) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-[(2,2-dimethylcyclopropyl)methoxymethyl]-3-phenyloxirane.
| Compound Name | 2-[(2,2-dimethylcyclopropyl)methoxymethyl]-3-phenyloxirane |
|---|---|
| PubChem CID | 20591378 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 2-[(2,2-dimethylcyclopropyl)methoxymethyl]-3-phenyloxirane |
| SMILES | CC1(C)CC1COCC1OC1c1ccccc1 |
| InChI | InChI=1S/C15H20O2/c1-15(2)8-12(15)9-16-10-13-14(17-13)11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3 |
| InChIKey | FABFBSMIQJGHRP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|