C17H16ClNO3 — CID 132544961
(4R)-4-[(S)-chloro(phenyl)methyl]-3-(4-methoxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 132544961) has the molecular formula C17H16ClNO3 and a molecular weight of 317.77 g/mol. Its IUPAC name is (4R)-4-[(S)-chloro(phenyl)methyl]-3-(4-methoxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-[(S)-chloro(phenyl)methyl]-3-(4-methoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 132544961 |
| Molecular Formula | C17H16ClNO3 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (4R)-4-[(S)-chloro(phenyl)methyl]-3-(4-methoxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(N2C(=O)OC[C@@H]2[C@@H](Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16ClNO3/c1-21-14-9-7-13(8-10-14)19-15(11-22-17(19)20)16(18)12-5-3-2-4-6-12/h2-10,15-16H,11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | KUJJZGNDLPCVEU-CVEARBPZSA-N |
| XLogP | 4.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|