About [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate
[(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate (PubChem CID 132545871) has the molecular formula C18H19ClO4
and a molecular weight of 334.80 g/mol. Its IUPAC name is [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate.
Molecular Properties
| Compound Name | [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate |
| PubChem CID | 132545871 |
| Molecular Formula | C18H19ClO4 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC[C@](Cl)(CO)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19ClO4/c1-22-16-9-7-15(8-10-16)17(21)23-13-18(19,12-20)11-14-5-3-2-4-6-14/h2-10,20H,11-13H2,1H3/t18-/m1/s1 |
| InChIKey | SDVAMKASEAYCOW-GOSISDBHSA-N |
| XLogP | 3.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate?
The IUPAC name of [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate (CID 132545871) is [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate.
What is the SMILES notation for [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate?
The canonical SMILES for [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate is COc1ccc(C(=O)OC[C@](Cl)(CO)Cc2ccccc2)cc1.
What is the InChIKey of [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate?
The InChIKey is SDVAMKASEAYCOW-GOSISDBHSA-N. The full InChI is InChI=1S/C18H19ClO4/c1-22-16-9-7-15(8-10-16)17(21)23-13-18(19,12-20)11-14-5-3-2-4-6-14/h2-10,20H,11-13H2,1H3/t18-/m1/s1.
What are the key properties of [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate?
[(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate has a molecular weight of 334.80 g/mol, XLogP of 3.06, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-benzyl-2-chloro-3-hydroxypropyl] 4-methoxybenzoate is sourced from PubChem (CID 132545871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).