C17H19F3O4SSi — CID 132547025
[2-(4-methoxyphenyl)-6-trimethylsilylphenyl] trifluoromethanesulfonate (PubChem CID 132547025) has the molecular formula C17H19F3O4SSi and a molecular weight of 404.48 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-6-trimethylsilylphenyl] trifluoromethanesulfonate.
| Compound Name | [2-(4-methoxyphenyl)-6-trimethylsilylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 132547025 |
| Molecular Formula | C17H19F3O4SSi |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | [2-(4-methoxyphenyl)-6-trimethylsilylphenyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(-c2cccc([Si](C)(C)C)c2OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3O4SSi/c1-23-13-10-8-12(9-11-13)14-6-5-7-15(26(2,3)4)16(14)24-25(21,22)17(18,19)20/h5-11H,1-4H3 |
| InChIKey | DIEADMOGLZESSN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|