C17H12F6O7S2 — CID 13270841
[(Z)-2-(4-methoxyphenyl)-1-phenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate (PubChem CID 13270841) has the molecular formula C17H12F6O7S2 and a molecular weight of 506.40 g/mol. Its IUPAC name is [(Z)-2-(4-methoxyphenyl)-1-phenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate.
| Compound Name | [(Z)-2-(4-methoxyphenyl)-1-phenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 13270841 |
| Molecular Formula | C17H12F6O7S2 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | [(Z)-2-(4-methoxyphenyl)-1-phenyl-2-(trifluoromethylsulfonyloxy)ethenyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(/C(OS(=O)(=O)C(F)(F)F)=C(/OS(=O)(=O)C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H12F6O7S2/c1-28-13-9-7-12(8-10-13)15(30-32(26,27)17(21,22)23)14(11-5-3-2-4-6-11)29-31(24,25)16(18,19)20/h2-10H,1H3/b15-14- |
| InChIKey | FDGKLKMYUPKCNG-PFONDFGASA-N |
| XLogP | 4.25 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|