C16H8N4O2S — CID 132548840
4,6-dioxo-2-thiophen-2-yl-11H-pyrimido[2,1-b]quinazoline-3-carbonitrile (PubChem CID 132548840) has the molecular formula C16H8N4O2S and a molecular weight of 320.33 g/mol. Its IUPAC name is 4,6-dioxo-2-thiophen-2-yl-11H-pyrimido[2,1-b]quinazoline-3-carbonitrile.
| Compound Name | 4,6-dioxo-2-thiophen-2-yl-11H-pyrimido[2,1-b]quinazoline-3-carbonitrile |
|---|---|
| PubChem CID | 132548840 |
| Molecular Formula | C16H8N4O2S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 4,6-dioxo-2-thiophen-2-yl-11H-pyrimido[2,1-b]quinazoline-3-carbonitrile |
| SMILES | N#Cc1c(-c2cccs2)nc2[nH]c3ccccc3c(=O)n2c1=O |
| InChI | InChI=1S/C16H8N4O2S/c17-8-10-13(12-6-3-7-23-12)19-16-18-11-5-2-1-4-9(11)14(21)20(16)15(10)22/h1-7H,(H,18,19) |
| InChIKey | AJAQHWZJZUDUMK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|