C24H21NO3 — CID 132551094
benzyl (4S)-4-benzyl-2-phenyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 132551094) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is benzyl (4S)-4-benzyl-2-phenyl-5H-1,3-oxazole-4-carboxylate.
| Compound Name | benzyl (4S)-4-benzyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 132551094 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | benzyl (4S)-4-benzyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@]1(Cc2ccccc2)COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C24H21NO3/c26-23(27-17-20-12-6-2-7-13-20)24(16-19-10-4-1-5-11-19)18-28-22(25-24)21-14-8-3-9-15-21/h1-15H,16-18H2/t24-/m0/s1 |
| InChIKey | HNFNVLADLPXHRH-DEOSSOPVSA-N |
| XLogP | 4.19 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |