C14H13NO3 — CID 11470557
methyl (4R)-2-phenyl-4-prop-2-ynyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 11470557) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is methyl (4R)-2-phenyl-4-prop-2-ynyl-5H-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4R)-2-phenyl-4-prop-2-ynyl-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11470557 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | methyl (4R)-2-phenyl-4-prop-2-ynyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | C#CC[C@]1(C(=O)OC)COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C14H13NO3/c1-3-9-14(13(16)17-2)10-18-12(15-14)11-7-5-4-6-8-11/h1,4-8H,9-10H2,2H3/t14-/m1/s1 |
| InChIKey | MBGJKPNESMTMFW-CQSZACIVSA-N |
| XLogP | 1.40 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|