C27H25NO2 — CID 132551759
(2E,8R)-2-[(4-methoxyphenyl)methylidene]-6,6-diphenyl-1,5,7,8-tetrahydropyrrolizin-3-one (PubChem CID 132551759) has the molecular formula C27H25NO2 and a molecular weight of 395.50 g/mol. Its IUPAC name is (2E,8R)-2-[(4-methoxyphenyl)methylidene]-6,6-diphenyl-1,5,7,8-tetrahydropyrrolizin-3-one.
| Compound Name | (2E,8R)-2-[(4-methoxyphenyl)methylidene]-6,6-diphenyl-1,5,7,8-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 132551759 |
| Molecular Formula | C27H25NO2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (2E,8R)-2-[(4-methoxyphenyl)methylidene]-6,6-diphenyl-1,5,7,8-tetrahydropyrrolizin-3-one |
| SMILES | COc1ccc(/C=C2\C[C@H]3CC(c4ccccc4)(c4ccccc4)CN3C2=O)cc1 |
| InChI | InChI=1S/C27H25NO2/c1-30-25-14-12-20(13-15-25)16-21-17-24-18-27(19-28(24)26(21)29,22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-16,24H,17-19H2,1H3/b21-16+/t24-/m0/s1 |
| InChIKey | UDNWPFXIALTTEP-VGBYGFDOSA-N |
| XLogP | 5.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|