C26H16O6 — CID 132552558
9-(4,5-dihydroxyxanthen-9-ylidene)xanthene-4,5-diol (PubChem CID 132552558) has the molecular formula C26H16O6 and a molecular weight of 424.41 g/mol. Its IUPAC name is 9-(4,5-dihydroxyxanthen-9-ylidene)xanthene-4,5-diol.
| Compound Name | 9-(4,5-dihydroxyxanthen-9-ylidene)xanthene-4,5-diol |
|---|---|
| PubChem CID | 132552558 |
| Molecular Formula | C26H16O6 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 9-(4,5-dihydroxyxanthen-9-ylidene)xanthene-4,5-diol |
| SMILES | Oc1cccc2c1Oc1c(O)cccc1C2=C1c2cccc(O)c2Oc2c(O)cccc21 |
| InChI | InChI=1S/C26H16O6/c27-17-9-1-5-13-21(14-6-2-10-18(28)24(14)31-23(13)17)22-15-7-3-11-19(29)25(15)32-26-16(22)8-4-12-20(26)30/h1-12,27-30H |
| InChIKey | NGXQKZPOPJSZGU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|