C29H40O7 — CID 132553131
[(1S,2R,6R,10S,11R,13S,14R,15R)-8-formyl-1,6-dihydroxy-4,12,12,15-tetramethyl-13-(2-methylpropanoyloxy)-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-2-methylbut-2-enoate (PubChem CID 132553131) has the molecular formula C29H40O7 and a molecular weight of 500.63 g/mol. Its IUPAC name is [(1S,2R,6R,10S,11R,13S,14R,15R)-8-formyl-1,6-dihydroxy-4,12,12,15-tetramethyl-13-(2-methylpropanoyloxy)-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1S,2R,6R,10S,11R,13S,14R,15R)-8-formyl-1,6-dihydroxy-4,12,12,15-tetramethyl-13-(2-methylpropanoyloxy)-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 132553131 |
| Molecular Formula | C29H40O7 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | [(1S,2R,6R,10S,11R,13S,14R,15R)-8-formyl-1,6-dihydroxy-4,12,12,15-tetramethyl-13-(2-methylpropanoyloxy)-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1[C@@H](C)[C@]2(O)[C@@H]3C=C(C)C[C@@]3(O)CC(C=O)=C[C@H]2[C@@H]2C(C)(C)[C@]12OC(=O)C(C)C |
| InChI | InChI=1S/C29H40O7/c1-9-17(5)25(32)35-23-18(6)28(34)20(22-26(7,8)29(22,23)36-24(31)15(2)3)11-19(14-30)13-27(33)12-16(4)10-21(27)28/h9-11,14-15,18,20-23,33-34H,12-13H2,1-8H3/b17-9+/t18-,20+,21-,22-,23-,27-,28-,29-/m1/s1 |
| InChIKey | YYYYUSJDXQRMPI-LSFSYHLNSA-N |
| XLogP | 3.68 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|