C27H38O8 — CID 98051777
[(1R,2R,6S,10S,11R,13R,14S,15R)-14-acetyloxy-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2R)-2-methylbutanoate (PubChem CID 98051777) has the molecular formula C27H38O8 and a molecular weight of 490.59 g/mol. Its IUPAC name is [(1R,2R,6S,10S,11R,13R,14S,15R)-14-acetyloxy-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2R)-2-methylbutanoate.
| Compound Name | [(1R,2R,6S,10S,11R,13R,14S,15R)-14-acetyloxy-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 98051777 |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | [(1R,2R,6S,10S,11R,13R,14S,15R)-14-acetyloxy-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)O[C@@]12[C@H]([C@@H]3C=C(CO)C[C@@]4(O)C(=O)C(C)=C[C@@H]4[C@]3(O)[C@H](C)[C@@H]1OC(C)=O)C2(C)C |
| InChI | InChI=1S/C27H38O8/c1-8-13(2)23(31)35-27-20(24(27,6)7)18-10-17(12-28)11-25(32)19(9-14(3)21(25)30)26(18,33)15(4)22(27)34-16(5)29/h9-10,13,15,18-20,22,28,32-33H,8,11-12H2,1-7H3/t13-,15-,18+,19+,20-,22+,25+,26+,27+/m1/s1 |
| InChIKey | LJNNQVFOVQWDMN-QNFKCMMFSA-N |
| XLogP | 2.10 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|