C22H29NO3S — CID 132553163
(1R,6R,8S)-11-(4-methylphenyl)sulfonyl-8-prop-1-en-2-yl-11-azatricyclo[6.4.1.01,6]tridecan-7-one (PubChem CID 132553163) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is (1R,6R,8S)-11-(4-methylphenyl)sulfonyl-8-prop-1-en-2-yl-11-azatricyclo[6.4.1.01,6]tridecan-7-one.
| Compound Name | (1R,6R,8S)-11-(4-methylphenyl)sulfonyl-8-prop-1-en-2-yl-11-azatricyclo[6.4.1.01,6]tridecan-7-one |
|---|---|
| PubChem CID | 132553163 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (1R,6R,8S)-11-(4-methylphenyl)sulfonyl-8-prop-1-en-2-yl-11-azatricyclo[6.4.1.01,6]tridecan-7-one |
| SMILES | C=C(C)[C@]12CCN(S(=O)(=O)c3ccc(C)cc3)C[C@]3(CCCC[C@H]3C1=O)C2 |
| InChI | InChI=1S/C22H29NO3S/c1-16(2)22-12-13-23(27(25,26)18-9-7-17(3)8-10-18)15-21(14-22)11-5-4-6-19(21)20(22)24/h7-10,19H,1,4-6,11-15H2,2-3H3/t19-,21-,22+/m0/s1 |
| InChIKey | IWQLUOOOJZNDIR-ILWGZMRPSA-N |
| XLogP | 4.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|